C13H22 — CID 85195042
7,7-dimethyl-1,2,3,3a,3b,4,5,6,6a,7a-decahydrocyclopenta[a]pentalene (PubChem CID 85195042) has the molecular formula C13H22 and a molecular weight of 178.32 g/mol. Its IUPAC name is 7,7-dimethyl-1,2,3,3a,3b,4,5,6,6a,7a-decahydrocyclopenta[a]pentalene.
| Compound Name | 7,7-dimethyl-1,2,3,3a,3b,4,5,6,6a,7a-decahydrocyclopenta[a]pentalene |
|---|---|
| PubChem CID | 85195042 |
| Molecular Formula | C13H22 |
| Molecular Weight | 178.32 g/mol |
| Exact Mass | 178.17 |
| IUPAC Name | 7,7-dimethyl-1,2,3,3a,3b,4,5,6,6a,7a-decahydrocyclopenta[a]pentalene |
| SMILES | CC1(C)C2CCCC2C2CCCC21 |
| InChI | InChI=1S/C13H22/c1-13(2)11-7-3-5-9(11)10-6-4-8-12(10)13/h9-12H,3-8H2,1-2H3 |
| InChIKey | FIMSBWJLDMMPIC-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |