C25H41B — CID 173480325
CID 173480325 (PubChem CID 173480325) has the molecular formula C25H41B and a molecular weight of 352.42 g/mol.
| Compound Name | CID 173480325 |
|---|---|
| PubChem CID | 173480325 |
| Molecular Formula | C25H41B |
| Molecular Weight | 352.42 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | — |
| SMILES | [B]C1CCC2CCC(C3CC[C@@H]4C5CCCCC5C(C)(C)C4C3)CC2C1 |
| InChI | InChI=1S/C25H41B/c1-25(2)23-6-4-3-5-21(23)22-12-10-18(15-24(22)25)17-8-7-16-9-11-20(26)14-19(16)13-17/h16-24H,3-15H2,1-2H3/t16?,17?,18?,19?,20?,21?,22-,23?,24?/m1/s1 |
| InChIKey | CRQMIPKICHCQJS-LVWGAHHTSA-N |
| XLogP | 7.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.42 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|