C8H19P — CID 171834213
(5R)-6,6-dimethylbicyclo[3.1.0]hexane;molecular hydrogen;phosphane (PubChem CID 171834213) has the molecular formula C8H19P and a molecular weight of 146.21 g/mol. Its IUPAC name is (5R)-6,6-dimethylbicyclo[3.1.0]hexane;molecular hydrogen;phosphane.
| Compound Name | (5R)-6,6-dimethylbicyclo[3.1.0]hexane;molecular hydrogen;phosphane |
|---|---|
| PubChem CID | 171834213 |
| Molecular Formula | C8H19P |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.12 |
| IUPAC Name | (5R)-6,6-dimethylbicyclo[3.1.0]hexane;molecular hydrogen;phosphane |
| SMILES | CC1(C)C2CCC[C@H]21.P.[H][H] |
| InChI | InChI=1S/C8H14.H3P.H2/c1-8(2)6-4-3-5-7(6)8;;/h6-7H,3-5H2,1-2H3;1H3;1H/t6-,7?;;/m1../s1 |
| InChIKey | CRYWKOIOJGYYSW-DKPBNVODSA-N |
| XLogP | 2.75 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|