C12H21F — CID 22156449
7-fluoro-8,8-dimethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene (PubChem CID 22156449) has the molecular formula C12H21F and a molecular weight of 184.30 g/mol. Its IUPAC name is 7-fluoro-8,8-dimethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene.
| Compound Name | 7-fluoro-8,8-dimethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene |
|---|---|
| PubChem CID | 22156449 |
| Molecular Formula | C12H21F |
| Molecular Weight | 184.30 g/mol |
| Exact Mass | 184.16 |
| IUPAC Name | 7-fluoro-8,8-dimethyl-2,3,4,4a,5,6,7,8a-octahydro-1H-naphthalene |
| SMILES | CC1(C)C(F)CCC2CCCCC21 |
| InChI | InChI=1S/C12H21F/c1-12(2)10-6-4-3-5-9(10)7-8-11(12)13/h9-11H,3-8H2,1-2H3 |
| InChIKey | RPHPRKNNXOTIRH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.30 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |