C12H20F2 — CID 125450825
(2R)-2-cyclohexyl-1,1-difluorocyclohexane (PubChem CID 125450825) has the molecular formula C12H20F2 and a molecular weight of 202.29 g/mol. Its IUPAC name is (2R)-2-cyclohexyl-1,1-difluorocyclohexane.
| Compound Name | (2R)-2-cyclohexyl-1,1-difluorocyclohexane |
|---|---|
| PubChem CID | 125450825 |
| Molecular Formula | C12H20F2 |
| Molecular Weight | 202.29 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (2R)-2-cyclohexyl-1,1-difluorocyclohexane |
| SMILES | FC1(F)CCCC[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C12H20F2/c13-12(14)9-5-4-8-11(12)10-6-2-1-3-7-10/h10-11H,1-9H2/t11-/m1/s1 |
| InChIKey | VMCJMKSXBXGEGB-LLVKDONJSA-N |
| XLogP | 4.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.29 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |