C7H10F2 — CID 163491628
(1R,6S)-2,2-difluorobicyclo[4.1.0]heptane (PubChem CID 163491628) has the molecular formula C7H10F2 and a molecular weight of 132.15 g/mol. Its IUPAC name is (1R,6S)-2,2-difluorobicyclo[4.1.0]heptane.
| Compound Name | (1R,6S)-2,2-difluorobicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 163491628 |
| Molecular Formula | C7H10F2 |
| Molecular Weight | 132.15 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (1R,6S)-2,2-difluorobicyclo[4.1.0]heptane |
| SMILES | FC1(F)CCC[C@H]2C[C@H]21 |
| InChI | InChI=1S/C7H10F2/c8-7(9)3-1-2-5-4-6(5)7/h5-6H,1-4H2/t5-,6+/m0/s1 |
| InChIKey | LIPZLDFKVLBEEM-NTSWFWBYSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 132.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |