C8H13F2N — CID 129374954
(3aR,7aS)-7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole (PubChem CID 129374954) has the molecular formula C8H13F2N and a molecular weight of 161.19 g/mol. Its IUPAC name is (3aR,7aS)-7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole.
| Compound Name | (3aR,7aS)-7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole |
|---|---|
| PubChem CID | 129374954 |
| Molecular Formula | C8H13F2N |
| Molecular Weight | 161.19 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (3aR,7aS)-7,7-difluoro-1,2,3,3a,4,5,6,7a-octahydroisoindole |
| SMILES | FC1(F)CCC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C8H13F2N/c9-8(10)3-1-2-6-4-11-5-7(6)8/h6-7,11H,1-5H2/t6-,7+/m0/s1 |
| InChIKey | QMVPTWXGZCVQFG-NKWVEPMBSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.19 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |