C14H18FNO — CID 100876188
(3aS,4R,7aR)-4-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol (PubChem CID 100876188) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is (3aS,4R,7aR)-4-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol.
| Compound Name | (3aS,4R,7aR)-4-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
|---|---|
| PubChem CID | 100876188 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (3aS,4R,7aR)-4-(4-fluorophenyl)-1,2,3,3a,5,6,7,7a-octahydroisoindol-4-ol |
| SMILES | O[C@]1(c2ccc(F)cc2)CCC[C@H]2CNC[C@H]21 |
| InChI | InChI=1S/C14H18FNO/c15-12-5-3-11(4-6-12)14(17)7-1-2-10-8-16-9-13(10)14/h3-6,10,13,16-17H,1-2,7-9H2/t10-,13+,14-/m0/s1 |
| InChIKey | KADNKMBDWLQVRJ-GDLCADMTSA-N |
| XLogP | 2.03 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |