C18H18F2O2 — CID 10709619
1,4-bis(4-fluorophenyl)cyclohexane-1,4-diol (PubChem CID 10709619) has the molecular formula C18H18F2O2 and a molecular weight of 304.34 g/mol. Its IUPAC name is 1,4-bis(4-fluorophenyl)cyclohexane-1,4-diol.
| Compound Name | 1,4-bis(4-fluorophenyl)cyclohexane-1,4-diol |
|---|---|
| PubChem CID | 10709619 |
| Molecular Formula | C18H18F2O2 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | 1,4-bis(4-fluorophenyl)cyclohexane-1,4-diol |
| SMILES | OC1(c2ccc(F)cc2)CCC(O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C18H18F2O2/c19-15-5-1-13(2-6-15)17(21)9-11-18(22,12-10-17)14-3-7-16(20)8-4-14/h1-8,21-22H,9-12H2 |
| InChIKey | VJSBUBCCKOMQHA-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |