C19H20F2O2 — CID 101158460
cis-(1R,4S)-1,4-bis(4-fluorophenyl)cycloheptane-1,4-diol (PubChem CID 101158460) has the molecular formula C19H20F2O2 and a molecular weight of 318.36 g/mol. Its IUPAC name is cis-(1R,4S)-1,4-bis(4-fluorophenyl)cycloheptane-1,4-diol.
| Compound Name | cis-(1R,4S)-1,4-bis(4-fluorophenyl)cycloheptane-1,4-diol |
|---|---|
| PubChem CID | 101158460 |
| Molecular Formula | C19H20F2O2 |
| Molecular Weight | 318.36 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | cis-(1R,4S)-1,4-bis(4-fluorophenyl)cycloheptane-1,4-diol |
| SMILES | O[C@]1(c2ccc(F)cc2)CCC[C@@](O)(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C19H20F2O2/c20-16-6-2-14(3-7-16)18(22)10-1-11-19(23,13-12-18)15-4-8-17(21)9-5-15/h2-9,22-23H,1,10-13H2/t18-,19+ |
| InChIKey | BCWSKUZFXAOFBV-KDURUIRLSA-N |
| XLogP | 4.00 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.36 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |