C12H15FOS — CID 125427250
(3S,6R)-3-(4-fluorophenyl)-6-methylthian-3-ol (PubChem CID 125427250) has the molecular formula C12H15FOS and a molecular weight of 226.32 g/mol. Its IUPAC name is (3S,6R)-3-(4-fluorophenyl)-6-methylthian-3-ol.
| Compound Name | (3S,6R)-3-(4-fluorophenyl)-6-methylthian-3-ol |
|---|---|
| PubChem CID | 125427250 |
| Molecular Formula | C12H15FOS |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | (3S,6R)-3-(4-fluorophenyl)-6-methylthian-3-ol |
| SMILES | C[C@@H]1CC[C@](O)(c2ccc(F)cc2)CS1 |
| InChI | InChI=1S/C12H15FOS/c1-9-6-7-12(14,8-15-9)10-2-4-11(13)5-3-10/h2-5,9,14H,6-8H2,1H3/t9-,12-/m1/s1 |
| InChIKey | ZBLSOKLBFJZCCW-BXKDBHETSA-N |
| XLogP | 2.93 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |