C17H24FNO — CID 20668518
1-(4-fluorophenyl)-4-(3-methylpyrrolidin-1-yl)cyclohexan-1-ol (PubChem CID 20668518) has the molecular formula C17H24FNO and a molecular weight of 277.38 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-4-(3-methylpyrrolidin-1-yl)cyclohexan-1-ol.
| Compound Name | 1-(4-fluorophenyl)-4-(3-methylpyrrolidin-1-yl)cyclohexan-1-ol |
|---|---|
| PubChem CID | 20668518 |
| Molecular Formula | C17H24FNO |
| Molecular Weight | 277.38 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 1-(4-fluorophenyl)-4-(3-methylpyrrolidin-1-yl)cyclohexan-1-ol |
| SMILES | CC1CCN(C2CCC(O)(c3ccc(F)cc3)CC2)C1 |
| InChI | InChI=1S/C17H24FNO/c1-13-8-11-19(12-13)16-6-9-17(20,10-7-16)14-2-4-15(18)5-3-14/h2-5,13,16,20H,6-12H2,1H3 |
| InChIKey | RKDKNQLUTCDTRW-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.38 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |