C26H29FN2O2 — CID 140945186
(3S,4R)-1-[4-(4-fluorophenyl)-4-isocyanocyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylic acid (PubChem CID 140945186) has the molecular formula C26H29FN2O2 and a molecular weight of 420.53 g/mol. Its IUPAC name is (3S,4R)-1-[4-(4-fluorophenyl)-4-isocyanocyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylic acid.
| Compound Name | (3S,4R)-1-[4-(4-fluorophenyl)-4-isocyanocyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 140945186 |
| Molecular Formula | C26H29FN2O2 |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | (3S,4R)-1-[4-(4-fluorophenyl)-4-isocyanocyclohexyl]-3-methyl-4-phenylpiperidine-4-carboxylic acid |
| SMILES | [C-]#[N+]C1(c2ccc(F)cc2)CCC(N2CC[C@](C(=O)O)(c3ccccc3)[C@H](C)C2)CC1 |
| InChI | InChI=1S/C26H29FN2O2/c1-19-18-29(17-16-26(19,24(30)31)21-6-4-3-5-7-21)23-12-14-25(28-2,15-13-23)20-8-10-22(27)11-9-20/h3-11,19,23H,12-18H2,1H3,(H,30,31)/t19-,23?,25?,26-/m1/s1 |
| InChIKey | CHTYTODSZQSSNV-YHYDXASRSA-N |
| XLogP | 5.25 |
| TPSA | 44.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|