C26H29FN2O3 — CID 155928983
(1R,3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-1-oxido-4-phenylpiperidin-1-ium-4-carboxylic acid (PubChem CID 155928983) has the molecular formula C26H29FN2O3 and a molecular weight of 436.53 g/mol. Its IUPAC name is (1R,3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-1-oxido-4-phenylpiperidin-1-ium-4-carboxylic acid.
| Compound Name | (1R,3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-1-oxido-4-phenylpiperidin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 155928983 |
| Molecular Formula | C26H29FN2O3 |
| Molecular Weight | 436.53 g/mol |
| Exact Mass | 436.22 |
| IUPAC Name | (1R,3S,4R)-1-[4-cyano-4-(4-fluorophenyl)cyclohexyl]-3-methyl-1-oxido-4-phenylpiperidin-1-ium-4-carboxylic acid |
| SMILES | C[C@@H]1C[N@@+]([O-])(C2CCC(C#N)(c3ccc(F)cc3)CC2)CC[C@]1(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C26H29FN2O3/c1-19-17-29(32,16-15-26(19,24(30)31)21-5-3-2-4-6-21)23-11-13-25(18-28,14-12-23)20-7-9-22(27)10-8-20/h2-10,19,23H,11-17H2,1H3,(H,30,31)/t19-,23?,25?,26-,29-/m1/s1 |
| InChIKey | IJBMBGSZRYDFRC-AHOGBWCLSA-N |
| XLogP | 4.91 |
| TPSA | 84.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.53 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|