C21H30FNO2 — CID 24799142
4-(4-fluorophenyl)-1-(4-propan-2-ylcyclohexyl)piperidine-4-carboxylic acid (PubChem CID 24799142) has the molecular formula C21H30FNO2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(4-propan-2-ylcyclohexyl)piperidine-4-carboxylic acid.
| Compound Name | 4-(4-fluorophenyl)-1-(4-propan-2-ylcyclohexyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 24799142 |
| Molecular Formula | C21H30FNO2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.23 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(4-propan-2-ylcyclohexyl)piperidine-4-carboxylic acid |
| SMILES | CC(C)C1CCC(N2CCC(C(=O)O)(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C21H30FNO2/c1-15(2)16-3-9-19(10-4-16)23-13-11-21(12-14-23,20(24)25)17-5-7-18(22)8-6-17/h5-8,15-16,19H,3-4,9-14H2,1-2H3,(H,24,25) |
| InChIKey | JXPVIVLHCWOYLH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |