C17H22FNO2 — CID 103677994
[1-(4-fluorophenyl)cyclopropyl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone (PubChem CID 103677994) has the molecular formula C17H22FNO2 and a molecular weight of 291.37 g/mol. Its IUPAC name is [1-(4-fluorophenyl)cyclopropyl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone.
| Compound Name | [1-(4-fluorophenyl)cyclopropyl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 103677994 |
| Molecular Formula | C17H22FNO2 |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | [1-(4-fluorophenyl)cyclopropyl]-[4-(1-hydroxyethyl)piperidin-1-yl]methanone |
| SMILES | CC(O)C1CCN(C(=O)C2(c3ccc(F)cc3)CC2)CC1 |
| InChI | InChI=1S/C17H22FNO2/c1-12(20)13-6-10-19(11-7-13)16(21)17(8-9-17)14-2-4-15(18)5-3-14/h2-5,12-13,20H,6-11H2,1H3 |
| InChIKey | FFUNENXCCWSOPQ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |