C23H32FNO2 — CID 86873749
(4-cyclohexyloxypiperidin-1-yl)-[1-(4-fluorophenyl)cyclopentyl]methanone (PubChem CID 86873749) has the molecular formula C23H32FNO2 and a molecular weight of 373.51 g/mol. Its IUPAC name is (4-cyclohexyloxypiperidin-1-yl)-[1-(4-fluorophenyl)cyclopentyl]methanone.
| Compound Name | (4-cyclohexyloxypiperidin-1-yl)-[1-(4-fluorophenyl)cyclopentyl]methanone |
|---|---|
| PubChem CID | 86873749 |
| Molecular Formula | C23H32FNO2 |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.24 |
| IUPAC Name | (4-cyclohexyloxypiperidin-1-yl)-[1-(4-fluorophenyl)cyclopentyl]methanone |
| SMILES | O=C(N1CCC(OC2CCCCC2)CC1)C1(c2ccc(F)cc2)CCCC1 |
| InChI | InChI=1S/C23H32FNO2/c24-19-10-8-18(9-11-19)23(14-4-5-15-23)22(26)25-16-12-21(13-17-25)27-20-6-2-1-3-7-20/h8-11,20-21H,1-7,12-17H2 |
| InChIKey | VJHPTXJXEVVDTO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |