C21H29FN2O3 — CID 55972279
tert-butyl N-[1-[1-(4-fluorophenyl)cyclobutanecarbonyl]piperidin-4-yl]carbamate (PubChem CID 55972279) has the molecular formula C21H29FN2O3 and a molecular weight of 376.47 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(4-fluorophenyl)cyclobutanecarbonyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(4-fluorophenyl)cyclobutanecarbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55972279 |
| Molecular Formula | C21H29FN2O3 |
| Molecular Weight | 376.47 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | tert-butyl N-[1-[1-(4-fluorophenyl)cyclobutanecarbonyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)C2(c3ccc(F)cc3)CCC2)CC1 |
| InChI | InChI=1S/C21H29FN2O3/c1-20(2,3)27-19(26)23-17-9-13-24(14-10-17)18(25)21(11-4-12-21)15-5-7-16(22)8-6-15/h5-8,17H,4,9-14H2,1-3H3,(H,23,26) |
| InChIKey | WYEBSTVXWNWVGD-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.47 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |