C24H36N4O4 — CID 55971633
tert-butyl N-[1-[1-(benzylcarbamoylamino)cyclopentanecarbonyl]piperidin-4-yl]carbamate (PubChem CID 55971633) has the molecular formula C24H36N4O4 and a molecular weight of 444.58 g/mol. Its IUPAC name is tert-butyl N-[1-[1-(benzylcarbamoylamino)cyclopentanecarbonyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[1-(benzylcarbamoylamino)cyclopentanecarbonyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55971633 |
| Molecular Formula | C24H36N4O4 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.27 |
| IUPAC Name | tert-butyl N-[1-[1-(benzylcarbamoylamino)cyclopentanecarbonyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)C2(NC(=O)NCc3ccccc3)CCCC2)CC1 |
| InChI | InChI=1S/C24H36N4O4/c1-23(2,3)32-22(31)26-19-11-15-28(16-12-19)20(29)24(13-7-8-14-24)27-21(30)25-17-18-9-5-4-6-10-18/h4-6,9-10,19H,7-8,11-17H2,1-3H3,(H,26,31)(H2,25,27,30) |
| InChIKey | DNCMJGBIMBCOJD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |