C13H14N2S2 — CID 140721764
4-isocyano-4-phenylpiperidine-1-carbodithioic acid (PubChem CID 140721764) has the molecular formula C13H14N2S2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 4-isocyano-4-phenylpiperidine-1-carbodithioic acid.
| Compound Name | 4-isocyano-4-phenylpiperidine-1-carbodithioic acid |
|---|---|
| PubChem CID | 140721764 |
| Molecular Formula | C13H14N2S2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-isocyano-4-phenylpiperidine-1-carbodithioic acid |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(C(=S)S)CC1 |
| InChI | InChI=1S/C13H14N2S2/c1-14-13(11-5-3-2-4-6-11)7-9-15(10-8-13)12(16)17/h2-6H,7-10H2,(H,16,17) |
| InChIKey | PBOFOFUVFRNRJH-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 7.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|