C12H15NO4 — CID 67332578
(3S,4S)-3,4-dihydroxy-4-phenylpiperidine-1-carboxylic acid (PubChem CID 67332578) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is (3S,4S)-3,4-dihydroxy-4-phenylpiperidine-1-carboxylic acid.
| Compound Name | (3S,4S)-3,4-dihydroxy-4-phenylpiperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 67332578 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | (3S,4S)-3,4-dihydroxy-4-phenylpiperidine-1-carboxylic acid |
| SMILES | O=C(O)N1CC[C@](O)(c2ccccc2)[C@@H](O)C1 |
| InChI | InChI=1S/C12H15NO4/c14-10-8-13(11(15)16)7-6-12(10,17)9-4-2-1-3-5-9/h1-5,10,14,17H,6-8H2,(H,15,16)/t10-,12-/m0/s1 |
| InChIKey | ACSBPNMLEBAHIC-JQWIXIFHSA-N |
| XLogP | 0.62 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |