C16H23NO4 — CID 20870871
tert-butyl 3,4-dihydroxy-4-phenylpiperidine-1-carboxylate (PubChem CID 20870871) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is tert-butyl 3,4-dihydroxy-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 3,4-dihydroxy-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 20870871 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | tert-butyl 3,4-dihydroxy-4-phenylpiperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(O)(c2ccccc2)C(O)C1 |
| InChI | InChI=1S/C16H23NO4/c1-15(2,3)21-14(19)17-10-9-16(20,13(18)11-17)12-7-5-4-6-8-12/h4-8,13,18,20H,9-11H2,1-3H3 |
| InChIKey | VZPOTZUPLUDJOL-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |