C38H56N4O6 — CID 158985906
tert-butyl 4-(dimethylcarbamoyl)-4-phenylpiperidine-1-carboxylate (PubChem CID 158985906) has the molecular formula C38H56N4O6 and a molecular weight of 664.89 g/mol. Its IUPAC name is tert-butyl 4-(dimethylcarbamoyl)-4-phenylpiperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(dimethylcarbamoyl)-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 158985906 |
| Molecular Formula | C38H56N4O6 |
| Molecular Weight | 664.89 g/mol |
| Exact Mass | 664.42 |
| IUPAC Name | tert-butyl 4-(dimethylcarbamoyl)-4-phenylpiperidine-1-carboxylate |
| SMILES | CN(C)C(=O)C1(c2ccccc2)CCN(C(=O)OC(C)(C)C)CC1.CN(C)C(=O)C1(c2ccccc2)CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/2C19H28N2O3/c2*1-18(2,3)24-17(23)21-13-11-19(12-14-21,16(22)20(4)5)15-9-7-6-8-10-15/h2*6-10H,11-14H2,1-5H3 |
| InChIKey | JPOJLGGEWOPJTQ-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.89 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |