C22H32N2O3 — CID 67422951
tert-butyl 4-phenyl-4-(piperidine-1-carbonyl)piperidine-1-carboxylate (PubChem CID 67422951) has the molecular formula C22H32N2O3 and a molecular weight of 372.51 g/mol. Its IUPAC name is tert-butyl 4-phenyl-4-(piperidine-1-carbonyl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-phenyl-4-(piperidine-1-carbonyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 67422951 |
| Molecular Formula | C22H32N2O3 |
| Molecular Weight | 372.51 g/mol |
| Exact Mass | 372.24 |
| IUPAC Name | tert-butyl 4-phenyl-4-(piperidine-1-carbonyl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)N2CCCCC2)(c2ccccc2)CC1 |
| InChI | InChI=1S/C22H32N2O3/c1-21(2,3)27-20(26)24-16-12-22(13-17-24,18-10-6-4-7-11-18)19(25)23-14-8-5-9-15-23/h4,6-7,10-11H,5,8-9,12-17H2,1-3H3 |
| InChIKey | IOZBQAOCOBSQGK-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.51 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |