C20H23NO4 — CID 77310302
ethyl 3,4-dihydroxy-4-(3-phenylphenyl)piperidine-1-carboxylate (PubChem CID 77310302) has the molecular formula C20H23NO4 and a molecular weight of 341.41 g/mol. Its IUPAC name is ethyl 3,4-dihydroxy-4-(3-phenylphenyl)piperidine-1-carboxylate.
| Compound Name | ethyl 3,4-dihydroxy-4-(3-phenylphenyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 77310302 |
| Molecular Formula | C20H23NO4 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.16 |
| IUPAC Name | ethyl 3,4-dihydroxy-4-(3-phenylphenyl)piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(O)(c2cccc(-c3ccccc3)c2)C(O)C1 |
| InChI | InChI=1S/C20H23NO4/c1-2-25-19(23)21-12-11-20(24,18(22)14-21)17-10-6-9-16(13-17)15-7-4-3-5-8-15/h3-10,13,18,22,24H,2,11-12,14H2,1H3 |
| InChIKey | OBTRYQLKRUUMNA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |