C15H21NO5 — CID 102421396
benzyl (3R)-3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate (PubChem CID 102421396) has the molecular formula C15H21NO5 and a molecular weight of 295.33 g/mol. Its IUPAC name is benzyl (3R)-3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate.
| Compound Name | benzyl (3R)-3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 102421396 |
| Molecular Formula | C15H21NO5 |
| Molecular Weight | 295.33 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | benzyl (3R)-3-hydroxy-4,4-dimethoxypiperidine-1-carboxylate |
| SMILES | COC1(OC)CCN(C(=O)OCc2ccccc2)C[C@H]1O |
| InChI | InChI=1S/C15H21NO5/c1-19-15(20-2)8-9-16(10-13(15)17)14(18)21-11-12-6-4-3-5-7-12/h3-7,13,17H,8-11H2,1-2H3/t13-/m1/s1 |
| InChIKey | YSTGJBDNTNVBIP-CYBMUJFWSA-N |
| XLogP | 1.38 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.33 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|