C21H22F3NO4 — CID 121378621
benzyl 4-hydroxy-3-phenylmethoxy-4-(trifluoromethyl)piperidine-1-carboxylate (PubChem CID 121378621) has the molecular formula C21H22F3NO4 and a molecular weight of 409.40 g/mol. Its IUPAC name is benzyl 4-hydroxy-3-phenylmethoxy-4-(trifluoromethyl)piperidine-1-carboxylate.
| Compound Name | benzyl 4-hydroxy-3-phenylmethoxy-4-(trifluoromethyl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 121378621 |
| Molecular Formula | C21H22F3NO4 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | benzyl 4-hydroxy-3-phenylmethoxy-4-(trifluoromethyl)piperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CCC(O)(C(F)(F)F)C(OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H22F3NO4/c22-21(23,24)20(27)11-12-25(19(26)29-15-17-9-5-2-6-10-17)13-18(20)28-14-16-7-3-1-4-8-16/h1-10,18,27H,11-15H2 |
| InChIKey | YIPSRTSDVOZKRJ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |