C13H14ClF2NO2 — CID 146262265
4,4-difluoro-3-phenylmethoxypiperidine-1-carbonyl chloride (PubChem CID 146262265) has the molecular formula C13H14ClF2NO2 and a molecular weight of 289.71 g/mol. Its IUPAC name is 4,4-difluoro-3-phenylmethoxypiperidine-1-carbonyl chloride.
| Compound Name | 4,4-difluoro-3-phenylmethoxypiperidine-1-carbonyl chloride |
|---|---|
| PubChem CID | 146262265 |
| Molecular Formula | C13H14ClF2NO2 |
| Molecular Weight | 289.71 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | 4,4-difluoro-3-phenylmethoxypiperidine-1-carbonyl chloride |
| SMILES | O=C(Cl)N1CCC(F)(F)C(OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H14ClF2NO2/c14-12(18)17-7-6-13(15,16)11(8-17)19-9-10-4-2-1-3-5-10/h1-5,11H,6-9H2 |
| InChIKey | SOCJYFCQCBAGII-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|