C20H22INO5 — CID 142093005
benzyl (3S,4S)-4-benzyl-4-hydroxy-3-iodosyloxypiperidine-1-carboxylate (PubChem CID 142093005) has the molecular formula C20H22INO5 and a molecular weight of 483.30 g/mol. Its IUPAC name is benzyl (3S,4S)-4-benzyl-4-hydroxy-3-iodosyloxypiperidine-1-carboxylate.
| Compound Name | benzyl (3S,4S)-4-benzyl-4-hydroxy-3-iodosyloxypiperidine-1-carboxylate |
|---|---|
| PubChem CID | 142093005 |
| Molecular Formula | C20H22INO5 |
| Molecular Weight | 483.30 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | benzyl (3S,4S)-4-benzyl-4-hydroxy-3-iodosyloxypiperidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1CC[C@@](O)(Cc2ccccc2)[C@@H](O[I+][O-])C1 |
| InChI | InChI=1S/C20H22INO5/c23-19(26-15-17-9-5-2-6-10-17)22-12-11-20(24,18(14-22)27-21-25)13-16-7-3-1-4-8-16/h1-10,18,24H,11-15H2/t18-,20+/m0/s1 |
| InChIKey | FTRLHHLZNBMDEW-AZUAARDMSA-N |
| XLogP | -1.33 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.30 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|