C15H19NO5 — CID 58371984
1-O-benzyl 3-O-methyl 3-methoxypyrrolidine-1,3-dicarboxylate (PubChem CID 58371984) has the molecular formula C15H19NO5 and a molecular weight of 293.32 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 3-methoxypyrrolidine-1,3-dicarboxylate.
| Compound Name | 1-O-benzyl 3-O-methyl 3-methoxypyrrolidine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 58371984 |
| Molecular Formula | C15H19NO5 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 3-methoxypyrrolidine-1,3-dicarboxylate |
| SMILES | COC(=O)C1(OC)CCN(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C15H19NO5/c1-19-13(17)15(20-2)8-9-16(11-15)14(18)21-10-12-6-4-3-5-7-12/h3-7H,8-11H2,1-2H3 |
| InChIKey | FYYYVSJBDFNSMQ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |