C17H24N2O3 — CID 169412914
1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]ethanone (PubChem CID 169412914) has the molecular formula C17H24N2O3 and a molecular weight of 304.39 g/mol. Its IUPAC name is 1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]ethanone.
| Compound Name | 1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]ethanone |
|---|---|
| PubChem CID | 169412914 |
| Molecular Formula | C17H24N2O3 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]ethanone |
| SMILES | CC(=O)N1CC[C@](O)(c2ccccc2)[C@H](N2CCOCC2)C1 |
| InChI | InChI=1S/C17H24N2O3/c1-14(20)19-8-7-17(21,15-5-3-2-4-6-15)16(13-19)18-9-11-22-12-10-18/h2-6,16,21H,7-13H2,1H3/t16-,17+/m1/s1 |
| InChIKey | QJZGFCTXKUHXPD-SJORKVTESA-N |
| XLogP | 0.83 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |