C24H31N3O5 — CID 171712344
formic acid;1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one (PubChem CID 171712344) has the molecular formula C24H31N3O5 and a molecular weight of 441.53 g/mol. Its IUPAC name is formic acid;1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one.
| Compound Name | formic acid;1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one |
|---|---|
| PubChem CID | 171712344 |
| Molecular Formula | C24H31N3O5 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.23 |
| IUPAC Name | formic acid;1-[(3R,4S)-4-hydroxy-3-morpholin-4-yl-4-phenylpiperidin-1-yl]-3-pyridin-2-ylpropan-1-one |
| SMILES | O=C(CCc1ccccn1)N1CC[C@](O)(c2ccccc2)[C@H](N2CCOCC2)C1.O=CO |
| InChI | InChI=1S/C23H29N3O3.CH2O2/c27-22(10-9-20-8-4-5-12-24-20)26-13-11-23(28,19-6-2-1-3-7-19)21(18-26)25-14-16-29-17-15-25;2-1-3/h1-8,12,21,28H,9-11,13-18H2;1H,(H,2,3)/t21-,23+;/m1./s1 |
| InChIKey | QZZDJSZJNIWRCU-QRIJJCFISA-N |
| XLogP | 1.54 |
| TPSA | 103.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|