C18H26N2O3 — CID 156601705
1-(4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-2-methoxyethanone (PubChem CID 156601705) has the molecular formula C18H26N2O3 and a molecular weight of 318.42 g/mol. Its IUPAC name is 1-(4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-2-methoxyethanone.
| Compound Name | 1-(4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-2-methoxyethanone |
|---|---|
| PubChem CID | 156601705 |
| Molecular Formula | C18H26N2O3 |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | 1-(4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-2-methoxyethanone |
| SMILES | COCC(=O)N1CCC(O)(c2ccccc2)C(N2CCCC2)C1 |
| InChI | InChI=1S/C18H26N2O3/c1-23-14-17(21)20-12-9-18(22,15-7-3-2-4-8-15)16(13-20)19-10-5-6-11-19/h2-4,7-8,16,22H,5-6,9-14H2,1H3 |
| InChIKey | MJBBLOYLOAIFBR-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |