C20H24N2O2S — CID 156601702
(4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-thiophen-3-ylmethanone (PubChem CID 156601702) has the molecular formula C20H24N2O2S and a molecular weight of 356.49 g/mol. Its IUPAC name is (4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-thiophen-3-ylmethanone.
| Compound Name | (4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 156601702 |
| Molecular Formula | C20H24N2O2S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | (4-hydroxy-4-phenyl-3-pyrrolidin-1-ylpiperidin-1-yl)-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)N1CCC(O)(c2ccccc2)C(N2CCCC2)C1 |
| InChI | InChI=1S/C20H24N2O2S/c23-19(16-8-13-25-15-16)22-12-9-20(24,17-6-2-1-3-7-17)18(14-22)21-10-4-5-11-21/h1-3,6-8,13,15,18,24H,4-5,9-12,14H2 |
| InChIKey | LALSGQHULQGMOP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |