C16H22N2O5S — CID 154915629
(4aS,8aS)-1-methyl-7-(thiophene-3-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid;formic acid (PubChem CID 154915629) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is (4aS,8aS)-1-methyl-7-(thiophene-3-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid;formic acid.
| Compound Name | (4aS,8aS)-1-methyl-7-(thiophene-3-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid;formic acid |
|---|---|
| PubChem CID | 154915629 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (4aS,8aS)-1-methyl-7-(thiophene-3-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid;formic acid |
| SMILES | CN1CCC[C@]2(C(=O)O)CCN(C(=O)c3ccsc3)C[C@@H]12.O=CO |
| InChI | InChI=1S/C15H20N2O3S.CH2O2/c1-16-6-2-4-15(14(19)20)5-7-17(9-12(15)16)13(18)11-3-8-21-10-11;2-1-3/h3,8,10,12H,2,4-7,9H2,1H3,(H,19,20);1H,(H,2,3)/t12-,15+;/m1./s1 |
| InChIKey | BCARBJRXEHOOQS-YLCXCWDSSA-N |
| XLogP | 1.46 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|