C17H21ClN2O3 — CID 135115571
(4aS,8aS)-7-(2-chlorobenzoyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid (PubChem CID 135115571) has the molecular formula C17H21ClN2O3 and a molecular weight of 336.82 g/mol. Its IUPAC name is (4aS,8aS)-7-(2-chlorobenzoyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aS)-7-(2-chlorobenzoyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 135115571 |
| Molecular Formula | C17H21ClN2O3 |
| Molecular Weight | 336.82 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | (4aS,8aS)-7-(2-chlorobenzoyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
| SMILES | CN1CCC[C@]2(C(=O)O)CCN(C(=O)c3ccccc3Cl)C[C@@H]12 |
| InChI | InChI=1S/C17H21ClN2O3/c1-19-9-4-7-17(16(22)23)8-10-20(11-14(17)19)15(21)12-5-2-3-6-13(12)18/h2-3,5-6,14H,4,7-11H2,1H3,(H,22,23)/t14-,17+/m1/s1 |
| InChIKey | BWNHYSJIWUCPPV-PBHICJAKSA-N |
| XLogP | 2.35 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.82 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |