C17H19F3N2O3 — CID 135094326
(4aS,8aS)-1-methyl-7-(2,4,5-trifluorobenzoyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid (PubChem CID 135094326) has the molecular formula C17H19F3N2O3 and a molecular weight of 356.34 g/mol. Its IUPAC name is (4aS,8aS)-1-methyl-7-(2,4,5-trifluorobenzoyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aS)-1-methyl-7-(2,4,5-trifluorobenzoyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 135094326 |
| Molecular Formula | C17H19F3N2O3 |
| Molecular Weight | 356.34 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | (4aS,8aS)-1-methyl-7-(2,4,5-trifluorobenzoyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
| SMILES | CN1CCC[C@]2(C(=O)O)CCN(C(=O)c3cc(F)c(F)cc3F)C[C@@H]12 |
| InChI | InChI=1S/C17H19F3N2O3/c1-21-5-2-3-17(16(24)25)4-6-22(9-14(17)21)15(23)10-7-12(19)13(20)8-11(10)18/h7-8,14H,2-6,9H2,1H3,(H,24,25)/t14-,17+/m1/s1 |
| InChIKey | DVXPQEVWBVZMFM-PBHICJAKSA-N |
| XLogP | 2.12 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.34 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|