C18H21N3O3S — CID 135117078
(4aS,8aS)-7-(1,3-benzothiazole-5-carbonyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid (PubChem CID 135117078) has the molecular formula C18H21N3O3S and a molecular weight of 359.45 g/mol. Its IUPAC name is (4aS,8aS)-7-(1,3-benzothiazole-5-carbonyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid.
| Compound Name | (4aS,8aS)-7-(1,3-benzothiazole-5-carbonyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
|---|---|
| PubChem CID | 135117078 |
| Molecular Formula | C18H21N3O3S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | (4aS,8aS)-7-(1,3-benzothiazole-5-carbonyl)-1-methyl-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridine-4a-carboxylic acid |
| SMILES | CN1CCC[C@]2(C(=O)O)CCN(C(=O)c3ccc4scnc4c3)C[C@@H]12 |
| InChI | InChI=1S/C18H21N3O3S/c1-20-7-2-5-18(17(23)24)6-8-21(10-15(18)20)16(22)12-3-4-14-13(9-12)19-11-25-14/h3-4,9,11,15H,2,5-8,10H2,1H3,(H,23,24)/t15-,18+/m1/s1 |
| InChIKey | IIGZQCTYQWXNTN-QAPCUYQASA-N |
| XLogP | 2.31 |
| TPSA | 73.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |