C21H27F2N3O3 — CID 138381441
[(4aR,8aR)-1-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3,4-difluorophenyl)methanone (PubChem CID 138381441) has the molecular formula C21H27F2N3O3 and a molecular weight of 407.46 g/mol. Its IUPAC name is [(4aR,8aR)-1-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(4aR,8aR)-1-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 138381441 |
| Molecular Formula | C21H27F2N3O3 |
| Molecular Weight | 407.46 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | [(4aR,8aR)-1-methyl-4a-(morpholine-4-carbonyl)-3,4,5,6,8,8a-hexahydro-2H-1,7-naphthyridin-7-yl]-(3,4-difluorophenyl)methanone |
| SMILES | CN1CCC[C@@]2(C(=O)N3CCOCC3)CCN(C(=O)c3ccc(F)c(F)c3)C[C@H]12 |
| InChI | InChI=1S/C21H27F2N3O3/c1-24-7-2-5-21(20(28)25-9-11-29-12-10-25)6-8-26(14-18(21)24)19(27)15-3-4-16(22)17(23)13-15/h3-4,13,18H,2,5-12,14H2,1H3/t18-,21+/m0/s1 |
| InChIKey | MYBUDTXKSQORMD-GHTZIAJQSA-N |
| XLogP | 1.75 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.46 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |