C12H13F2NO — CID 110749741
(3,4-difluorophenyl)-(3-methylpyrrolidin-1-yl)methanone (PubChem CID 110749741) has the molecular formula C12H13F2NO and a molecular weight of 225.24 g/mol. Its IUPAC name is (3,4-difluorophenyl)-(3-methylpyrrolidin-1-yl)methanone.
| Compound Name | (3,4-difluorophenyl)-(3-methylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 110749741 |
| Molecular Formula | C12H13F2NO |
| Molecular Weight | 225.24 g/mol |
| Exact Mass | 225.10 |
| IUPAC Name | (3,4-difluorophenyl)-(3-methylpyrrolidin-1-yl)methanone |
| SMILES | CC1CCN(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C12H13F2NO/c1-8-4-5-15(7-8)12(16)9-2-3-10(13)11(14)6-9/h2-3,6,8H,4-5,7H2,1H3 |
| InChIKey | ZSAZHUWUYFHETO-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.24 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |