C15H17F2NO2 — CID 97369452
[(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(3,4-difluorophenyl)methanone (PubChem CID 97369452) has the molecular formula C15H17F2NO2 and a molecular weight of 281.30 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(3,4-difluorophenyl)methanone.
| Compound Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(3,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 97369452 |
| Molecular Formula | C15H17F2NO2 |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-(3,4-difluorophenyl)methanone |
| SMILES | C[C@H]1C[C@@H]2CCN(C(=O)c3ccc(F)c(F)c3)C[C@H]2O1 |
| InChI | InChI=1S/C15H17F2NO2/c1-9-6-10-4-5-18(8-14(10)20-9)15(19)11-2-3-12(16)13(17)7-11/h2-3,7,9-10,14H,4-6,8H2,1H3/t9-,10-,14+/m0/s1 |
| InChIKey | KEBCRPWMYJGZCP-PKFCDNJMSA-N |
| XLogP | 2.60 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |