C14H18N2O2 — CID 97385070
[(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridin-3-ylmethanone (PubChem CID 97385070) has the molecular formula C14H18N2O2 and a molecular weight of 246.31 g/mol. Its IUPAC name is [(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridin-3-ylmethanone.
| Compound Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 97385070 |
| Molecular Formula | C14H18N2O2 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | [(2S,3aS,7aS)-2-methyl-3,3a,4,5,7,7a-hexahydro-2H-furo[2,3-c]pyridin-6-yl]-pyridin-3-ylmethanone |
| SMILES | C[C@H]1C[C@@H]2CCN(C(=O)c3cccnc3)C[C@H]2O1 |
| InChI | InChI=1S/C14H18N2O2/c1-10-7-11-4-6-16(9-13(11)18-10)14(17)12-3-2-5-15-8-12/h2-3,5,8,10-11,13H,4,6-7,9H2,1H3/t10-,11-,13+/m0/s1 |
| InChIKey | DCXNLJBAKNOGIL-GMXVVIOVSA-N |
| XLogP | 1.72 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |