C11H12N2O2 — CID 98470590
[(1R,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]-pyridin-3-ylmethanone (PubChem CID 98470590) has the molecular formula C11H12N2O2 and a molecular weight of 204.23 g/mol. Its IUPAC name is [(1R,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]-pyridin-3-ylmethanone.
| Compound Name | [(1R,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]-pyridin-3-ylmethanone |
|---|---|
| PubChem CID | 98470590 |
| Molecular Formula | C11H12N2O2 |
| Molecular Weight | 204.23 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | [(1R,6R)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]-pyridin-3-ylmethanone |
| SMILES | O=C(c1cccnc1)N1CC[C@H]2O[C@@H]2C1 |
| InChI | InChI=1S/C11H12N2O2/c14-11(8-2-1-4-12-6-8)13-5-3-9-10(7-13)15-9/h1-2,4,6,9-10H,3,5,7H2/t9-,10-/m1/s1 |
| InChIKey | FPEGFCYDJFMQFY-NXEZZACHSA-N |
| XLogP | 0.69 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.23 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|