C11H11FN2O2 — CID 124854532
(3-fluoro-4-pyridinyl)-[(1S,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone (PubChem CID 124854532) has the molecular formula C11H11FN2O2 and a molecular weight of 222.22 g/mol. Its IUPAC name is (3-fluoro-4-pyridinyl)-[(1S,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone.
| Compound Name | (3-fluoro-4-pyridinyl)-[(1S,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone |
|---|---|
| PubChem CID | 124854532 |
| Molecular Formula | C11H11FN2O2 |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.08 |
| IUPAC Name | (3-fluoro-4-pyridinyl)-[(1S,6S)-7-oxa-3-azabicyclo[4.1.0]heptan-3-yl]methanone |
| SMILES | O=C(c1ccncc1F)N1CC[C@@H]2O[C@H]2C1 |
| InChI | InChI=1S/C11H11FN2O2/c12-8-5-13-3-1-7(8)11(15)14-4-2-9-10(6-14)16-9/h1,3,5,9-10H,2,4,6H2/t9-,10-/m0/s1 |
| InChIKey | XNIGLSOTMWWXCK-UWVGGRQHSA-N |
| XLogP | 0.83 |
| TPSA | 45.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|