C14H18FN3O4S — CID 98896074
[(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-fluoro-4-pyridinyl)methanone (PubChem CID 98896074) has the molecular formula C14H18FN3O4S and a molecular weight of 343.38 g/mol. Its IUPAC name is [(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-fluoro-4-pyridinyl)methanone.
| Compound Name | [(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-fluoro-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 98896074 |
| Molecular Formula | C14H18FN3O4S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | [(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-fluoro-4-pyridinyl)methanone |
| SMILES | CS(=O)(=O)N1CCO[C@H]2CCN(C(=O)c3ccncc3F)C[C@@H]21 |
| InChI | InChI=1S/C14H18FN3O4S/c1-23(20,21)18-6-7-22-13-3-5-17(9-12(13)18)14(19)10-2-4-16-8-11(10)15/h2,4,8,12-13H,3,5-7,9H2,1H3/t12-,13-/m0/s1 |
| InChIKey | AAHIBDUUOKOZRQ-STQMWFEESA-N |
| XLogP | 0.10 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |