C13H18N4O4S — CID 124781958
[(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone (PubChem CID 124781958) has the molecular formula C13H18N4O4S and a molecular weight of 326.38 g/mol. Its IUPAC name is [(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone.
| Compound Name | [(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone |
|---|---|
| PubChem CID | 124781958 |
| Molecular Formula | C13H18N4O4S |
| Molecular Weight | 326.38 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | [(4aR,8aR)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-pyrazin-2-ylmethanone |
| SMILES | CS(=O)(=O)N1CCO[C@@H]2CCN(C(=O)c3cnccn3)C[C@H]21 |
| InChI | InChI=1S/C13H18N4O4S/c1-22(19,20)17-6-7-21-12-2-5-16(9-11(12)17)13(18)10-8-14-3-4-15-10/h3-4,8,11-12H,2,5-7,9H2,1H3/t11-,12-/m1/s1 |
| InChIKey | CLPVXNJPNNHNCL-VXGBXAGGSA-N |
| XLogP | -0.65 |
| TPSA | 92.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.38 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |