C13H21FN2O4S — CID 131686881
[(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone (PubChem CID 131686881) has the molecular formula C13H21FN2O4S and a molecular weight of 320.39 g/mol. Its IUPAC name is [(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone.
| Compound Name | [(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone |
|---|---|
| PubChem CID | 131686881 |
| Molecular Formula | C13H21FN2O4S |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | [(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(1-fluorocyclobutyl)methanone |
| SMILES | CS(=O)(=O)N1CCO[C@H]2CCN(C(=O)C3(F)CCC3)C[C@@H]21 |
| InChI | InChI=1S/C13H21FN2O4S/c1-21(18,19)16-7-8-20-11-3-6-15(9-10(11)16)12(17)13(14)4-2-5-13/h10-11H,2-9H2,1H3/t10-,11-/m0/s1 |
| InChIKey | IJRKFVXLICZFJA-QWRGUYRKSA-N |
| XLogP | 0.14 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |