C16H26N2O4S — CID 131686695
[(4aS,8aS)-4-cyclopropylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylcyclobutyl)methanone (PubChem CID 131686695) has the molecular formula C16H26N2O4S and a molecular weight of 342.46 g/mol. Its IUPAC name is [(4aS,8aS)-4-cyclopropylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylcyclobutyl)methanone.
| Compound Name | [(4aS,8aS)-4-cyclopropylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylcyclobutyl)methanone |
|---|---|
| PubChem CID | 131686695 |
| Molecular Formula | C16H26N2O4S |
| Molecular Weight | 342.46 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | [(4aS,8aS)-4-cyclopropylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-(3-methylcyclobutyl)methanone |
| SMILES | CC1CC(C(=O)N2CC[C@@H]3OCCN(S(=O)(=O)C4CC4)[C@H]3C2)C1 |
| InChI | InChI=1S/C16H26N2O4S/c1-11-8-12(9-11)16(19)17-5-4-15-14(10-17)18(6-7-22-15)23(20,21)13-2-3-13/h11-15H,2-10H2,1H3/t11?,12?,14-,15-/m0/s1 |
| InChIKey | PTCXMZYGEINXBK-FWIFWCIWSA-N |
| XLogP | 0.83 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.46 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |