C12H22N2O6S2 — CID 131687281
1-[(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one (PubChem CID 131687281) has the molecular formula C12H22N2O6S2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one.
| Compound Name | 1-[(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 131687281 |
| Molecular Formula | C12H22N2O6S2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.09 |
| IUPAC Name | 1-[(4aS,8aS)-4-methylsulfonyl-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one |
| SMILES | CS(=O)(=O)CCC(=O)N1CC[C@@H]2OCCN(S(C)(=O)=O)[C@H]2C1 |
| InChI | InChI=1S/C12H22N2O6S2/c1-21(16,17)8-4-12(15)13-5-3-11-10(9-13)14(6-7-20-11)22(2,18)19/h10-11H,3-9H2,1-2H3/t10-,11-/m0/s1 |
| InChIKey | MCYWOIAJYZPVOM-QWRGUYRKSA-N |
| XLogP | -1.32 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | -1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |