C14H26N2O5S — CID 131686503
1-[(4aS,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one (PubChem CID 131686503) has the molecular formula C14H26N2O5S and a molecular weight of 334.44 g/mol. Its IUPAC name is 1-[(4aS,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one.
| Compound Name | 1-[(4aS,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one |
|---|---|
| PubChem CID | 131686503 |
| Molecular Formula | C14H26N2O5S |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 1-[(4aS,8aS)-4-(2-methoxyethyl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]-3-methylsulfonylpropan-1-one |
| SMILES | COCCN1CCO[C@H]2CCN(C(=O)CCS(C)(=O)=O)C[C@@H]21 |
| InChI | InChI=1S/C14H26N2O5S/c1-20-8-6-15-7-9-21-13-3-5-16(11-12(13)15)14(17)4-10-22(2,18)19/h12-13H,3-11H2,1-2H3/t12-,13-/m0/s1 |
| InChIKey | QAGDHRBPDDUNPU-STQMWFEESA-N |
| XLogP | -0.63 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |